About tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate
tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate (PubChem CID 171884245) has the molecular formula C13H23N3O4
and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate |
| PubChem CID | 171884245 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate |
| SMILES | Cc1ncc(C(O)C(O)CCNC(=O)OC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C13H23N3O4/c1-8-15-7-9(16-8)11(18)10(17)5-6-14-12(19)20-13(2,3)4/h7,10-11,17-18H,5-6H2,1-4H3,(H,14,19)(H,15,16) |
| InChIKey | DCSHYMZVVMGMCG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate?
The IUPAC name of tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate (CID 171884245) is tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate.
What is the SMILES notation for tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate?
The canonical SMILES for tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate is Cc1ncc(C(O)C(O)CCNC(=O)OC(C)(C)C)[nH]1.
What is the InChIKey of tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate?
The InChIKey is DCSHYMZVVMGMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O4/c1-8-15-7-9(16-8)11(18)10(17)5-6-14-12(19)20-13(2,3)4/h7,10-11,17-18H,5-6H2,1-4H3,(H,14,19)(H,15,16).
What are the key properties of tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate?
tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate has a molecular weight of 285.34 g/mol, XLogP of 1.03, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3,4-dihydroxy-4-(2-methyl-1H-imidazol-5-yl)butyl]carbamate is sourced from PubChem (CID 171884245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).