C15H23ClN2O4 — CID 171884554
tert-butyl N-[4-(6-chloro-4-methyl-3-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884554) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is tert-butyl N-[4-(6-chloro-4-methyl-3-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-chloro-4-methyl-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884554 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | tert-butyl N-[4-(6-chloro-4-methyl-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Cc1cc(Cl)ncc1C(O)C(O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23ClN2O4/c1-9-7-12(16)18-8-10(9)13(20)11(19)5-6-17-14(21)22-15(2,3)4/h7-8,11,13,19-20H,5-6H2,1-4H3,(H,17,21) |
| InChIKey | JYMIBDUOSQHJGS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|