C15H22Cl2N2O4 — CID 171884916
tert-butyl N-[4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884916) has the molecular formula C15H22Cl2N2O4 and a molecular weight of 365.26 g/mol. Its IUPAC name is tert-butyl N-[4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884916 |
| Molecular Formula | C15H22Cl2N2O4 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | tert-butyl N-[4-(4-amino-2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cc(Cl)c(N)cc1Cl |
| InChI | InChI=1S/C15H22Cl2N2O4/c1-15(2,3)23-14(22)19-5-4-12(20)13(21)8-6-10(17)11(18)7-9(8)16/h6-7,12-13,20-21H,4-5,18H2,1-3H3,(H,19,22) |
| InChIKey | OGFXZVXHZMCUPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|