C15H25N3O4 — CID 171884504
tert-butyl N-[4-(2,3-diaminophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884504) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl N-[4-(2,3-diaminophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,3-diaminophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884504 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl N-[4-(2,3-diaminophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cccc(N)c1N |
| InChI | InChI=1S/C15H25N3O4/c1-15(2,3)22-14(21)18-8-7-11(19)13(20)9-5-4-6-10(16)12(9)17/h4-6,11,13,19-20H,7-8,16-17H2,1-3H3,(H,18,21) |
| InChIKey | HGWVLHWSCTYLFW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|