C17H23NO4S — CID 171884984
tert-butyl N-[4-(1-benzothiophen-7-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884984) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl N-[4-(1-benzothiophen-7-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(1-benzothiophen-7-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884984 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | tert-butyl N-[4-(1-benzothiophen-7-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cccc2ccsc12 |
| InChI | InChI=1S/C17H23NO4S/c1-17(2,3)22-16(21)18-9-7-13(19)14(20)12-6-4-5-11-8-10-23-15(11)12/h4-6,8,10,13-14,19-20H,7,9H2,1-3H3,(H,18,21) |
| InChIKey | OYFLUHFVSRBCQY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |