C13H22N4O4 — CID 171884358
tert-butyl N-[4-(6-aminopyridazin-3-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884358) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl N-[4-(6-aminopyridazin-3-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-aminopyridazin-3-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884358 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | tert-butyl N-[4-(6-aminopyridazin-3-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ccc(N)nn1 |
| InChI | InChI=1S/C13H22N4O4/c1-13(2,3)21-12(20)15-7-6-9(18)11(19)8-4-5-10(14)17-16-8/h4-5,9,11,18-19H,6-7H2,1-3H3,(H2,14,17)(H,15,20) |
| InChIKey | HUFCFHMHBOJDII-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |