C16H23ClN2O6 — CID 171885502
2-amino-5-chloro-3-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]benzoic acid (PubChem CID 171885502) has the molecular formula C16H23ClN2O6 and a molecular weight of 374.82 g/mol. Its IUPAC name is 2-amino-5-chloro-3-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]benzoic acid.
| Compound Name | 2-amino-5-chloro-3-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]benzoic acid |
|---|---|
| PubChem CID | 171885502 |
| Molecular Formula | C16H23ClN2O6 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-amino-5-chloro-3-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cc(Cl)cc(C(=O)O)c1N |
| InChI | InChI=1S/C16H23ClN2O6/c1-16(2,3)25-15(24)19-5-4-11(20)13(21)9-6-8(17)7-10(12(9)18)14(22)23/h6-7,11,13,20-21H,4-5,18H2,1-3H3,(H,19,24)(H,22,23) |
| InChIKey | NBXDQCOANPPLEQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|