C12H17ClN2O4 — CID 171890878
2-amino-5-chloro-3-[1,2-dihydroxy-4-(methylamino)butyl]benzoic acid (PubChem CID 171890878) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-amino-5-chloro-3-[1,2-dihydroxy-4-(methylamino)butyl]benzoic acid.
| Compound Name | 2-amino-5-chloro-3-[1,2-dihydroxy-4-(methylamino)butyl]benzoic acid |
|---|---|
| PubChem CID | 171890878 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-amino-5-chloro-3-[1,2-dihydroxy-4-(methylamino)butyl]benzoic acid |
| SMILES | CNCCC(O)C(O)c1cc(Cl)cc(C(=O)O)c1N |
| InChI | InChI=1S/C12H17ClN2O4/c1-15-3-2-9(16)11(17)7-4-6(13)5-8(10(7)14)12(18)19/h4-5,9,11,15-17H,2-3,14H2,1H3,(H,18,19) |
| InChIKey | DJUSRWWXGYCJAI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|