C12H18N2O4 — CID 171881931
2-amino-3-(4-amino-1,2-dihydroxybutyl)-5-methylbenzoic acid (PubChem CID 171881931) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-3-(4-amino-1,2-dihydroxybutyl)-5-methylbenzoic acid.
| Compound Name | 2-amino-3-(4-amino-1,2-dihydroxybutyl)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 171881931 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-amino-3-(4-amino-1,2-dihydroxybutyl)-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(N)c(C(O)C(O)CCN)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-6-4-7(11(16)9(15)2-3-13)10(14)8(5-6)12(17)18/h4-5,9,11,15-16H,2-3,13-14H2,1H3,(H,17,18) |
| InChIKey | GFIIGHQEGIKHLC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|