C11H16N2O4 — CID 171881718
3-amino-4-(4-amino-1,2-dihydroxybutyl)benzoic acid (PubChem CID 171881718) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-amino-4-(4-amino-1,2-dihydroxybutyl)benzoic acid.
| Compound Name | 3-amino-4-(4-amino-1,2-dihydroxybutyl)benzoic acid |
|---|---|
| PubChem CID | 171881718 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-amino-4-(4-amino-1,2-dihydroxybutyl)benzoic acid |
| SMILES | NCCC(O)C(O)c1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C11H16N2O4/c12-4-3-9(14)10(15)7-2-1-6(11(16)17)5-8(7)13/h1-2,5,9-10,14-15H,3-4,12-13H2,(H,16,17) |
| InChIKey | PVVHYBXYEMFQMX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|