C11H14N2O5 — CID 171899635
3-amino-4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid (PubChem CID 171899635) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 3-amino-4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid.
| Compound Name | 3-amino-4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid |
|---|---|
| PubChem CID | 171899635 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-amino-4-(4-amino-1,2-dihydroxy-4-oxobutyl)benzoic acid |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C11H14N2O5/c12-7-3-5(11(17)18)1-2-6(7)10(16)8(14)4-9(13)15/h1-3,8,10,14,16H,4,12H2,(H2,13,15)(H,17,18) |
| InChIKey | KUICXSXLLXJPKN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|