C11H12BrNO5 — CID 171900309
4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-bromobenzoic acid (PubChem CID 171900309) has the molecular formula C11H12BrNO5 and a molecular weight of 318.12 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-bromobenzoic acid.
| Compound Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-bromobenzoic acid |
|---|---|
| PubChem CID | 171900309 |
| Molecular Formula | C11H12BrNO5 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-bromobenzoic acid |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C11H12BrNO5/c12-7-3-5(11(17)18)1-2-6(7)10(16)8(14)4-9(13)15/h1-3,8,10,14,16H,4H2,(H2,13,15)(H,17,18) |
| InChIKey | GQSPMGJKARQTPI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |