C11H13BrO4S — CID 171875227
3-bromo-4-(1,2-dihydroxy-4-sulfanylbutyl)benzoic acid (PubChem CID 171875227) has the molecular formula C11H13BrO4S and a molecular weight of 321.19 g/mol. Its IUPAC name is 3-bromo-4-(1,2-dihydroxy-4-sulfanylbutyl)benzoic acid.
| Compound Name | 3-bromo-4-(1,2-dihydroxy-4-sulfanylbutyl)benzoic acid |
|---|---|
| PubChem CID | 171875227 |
| Molecular Formula | C11H13BrO4S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 3-bromo-4-(1,2-dihydroxy-4-sulfanylbutyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(O)C(O)CCS)c(Br)c1 |
| InChI | InChI=1S/C11H13BrO4S/c12-8-5-6(11(15)16)1-2-7(8)10(14)9(13)3-4-17/h1-2,5,9-10,13-14,17H,3-4H2,(H,15,16) |
| InChIKey | DRRLBGNQDHDBGM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|