C12H12ClF3O4 — CID 171894740
4-(4-chloro-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzoic acid (PubChem CID 171894740) has the molecular formula C12H12ClF3O4 and a molecular weight of 312.67 g/mol. Its IUPAC name is 4-(4-chloro-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(4-chloro-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171894740 |
| Molecular Formula | C12H12ClF3O4 |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-(4-chloro-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(O)C(O)CCCl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3O4/c13-4-3-9(17)10(18)7-2-1-6(11(19)20)5-8(7)12(14,15)16/h1-2,5,9-10,17-18H,3-4H2,(H,19,20) |
| InChIKey | UBPREGJJDFXXGY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|