C11H10ClF3O4 — CID 171862973
4-(3-chloro-1,2-dihydroxypropyl)-3-(trifluoromethyl)benzoic acid (PubChem CID 171862973) has the molecular formula C11H10ClF3O4 and a molecular weight of 298.64 g/mol. Its IUPAC name is 4-(3-chloro-1,2-dihydroxypropyl)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(3-chloro-1,2-dihydroxypropyl)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171862973 |
| Molecular Formula | C11H10ClF3O4 |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-(3-chloro-1,2-dihydroxypropyl)-3-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(O)C(O)CCl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10ClF3O4/c12-4-8(16)9(17)6-2-1-5(10(18)19)3-7(6)11(13,14)15/h1-3,8-9,16-17H,4H2,(H,18,19) |
| InChIKey | FPEQYZTZTDFWKP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|