C12H12F3NO5 — CID 171900114
4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-(trifluoromethyl)benzoic acid (PubChem CID 171900114) has the molecular formula C12H12F3NO5 and a molecular weight of 307.22 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171900114 |
| Molecular Formula | C12H12F3NO5 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3-(trifluoromethyl)benzoic acid |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO5/c13-12(14,15)7-3-5(11(20)21)1-2-6(7)10(19)8(17)4-9(16)18/h1-3,8,10,17,19H,4H2,(H2,16,18)(H,20,21) |
| InChIKey | BQRGRQFKVKEJNY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |