C11H10F6N2O — CID 170875789
3-amino-3-[2,4-bis(trifluoromethyl)phenyl]propanamide (PubChem CID 170875789) has the molecular formula C11H10F6N2O and a molecular weight of 300.20 g/mol. Its IUPAC name is 3-amino-3-[2,4-bis(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-amino-3-[2,4-bis(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 170875789 |
| Molecular Formula | C11H10F6N2O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-amino-3-[2,4-bis(trifluoromethyl)phenyl]propanamide |
| SMILES | NC(=O)CC(N)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10F6N2O/c12-10(13,14)5-1-2-6(8(18)4-9(19)20)7(3-5)11(15,16)17/h1-3,8H,4,18H2,(H2,19,20) |
| InChIKey | AWKBJNROLMWXNI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |