C12H12ClF6N — CID 171210234
(1R)-1-[2,4-bis(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride (PubChem CID 171210234) has the molecular formula C12H12ClF6N and a molecular weight of 319.68 g/mol. Its IUPAC name is (1R)-1-[2,4-bis(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2,4-bis(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171210234 |
| Molecular Formula | C12H12ClF6N |
| Molecular Weight | 319.68 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (1R)-1-[2,4-bis(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1ccc(C(F)(F)F)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C12H11F6N.ClH/c1-2-3-10(19)8-5-4-7(11(13,14)15)6-9(8)12(16,17)18;/h2,4-6,10H,1,3,19H2;1H/t10-;/m1./s1 |
| InChIKey | REYSOVSLKNIOJT-HNCPQSOCSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|