C11H11F4N — CID 79016459
1-[2-fluoro-5-(trifluoromethyl)phenyl]but-3-en-1-amine (PubChem CID 79016459) has the molecular formula C11H11F4N and a molecular weight of 233.21 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]but-3-en-1-amine.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 79016459 |
| Molecular Formula | C11H11F4N |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H11F4N/c1-2-3-10(16)8-6-7(11(13,14)15)4-5-9(8)12/h2,4-6,10H,1,3,16H2 |
| InChIKey | VFDBRLLKNRFBGY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|