C11H11ClF3N — CID 171229179
(1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-amine (PubChem CID 171229179) has the molecular formula C11H11ClF3N and a molecular weight of 249.66 g/mol. Its IUPAC name is (1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-amine.
| Compound Name | (1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 171229179 |
| Molecular Formula | C11H11ClF3N |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (1S)-1-[2-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H11ClF3N/c1-2-3-10(16)8-6-7(11(13,14)15)4-5-9(8)12/h2,4-6,10H,1,3,16H2/t10-/m0/s1 |
| InChIKey | IWCZISLUZVOXIT-JTQLQIEISA-N |
| XLogP | 3.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|