C12H11F6NO2 — CID 171249314
methyl (3R)-3-amino-3-[2,5-bis(trifluoromethyl)phenyl]propanoate (PubChem CID 171249314) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-[2,5-bis(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (3R)-3-amino-3-[2,5-bis(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171249314 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | methyl (3R)-3-amino-3-[2,5-bis(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)C[C@@H](N)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H11F6NO2/c1-21-10(20)5-9(19)7-4-6(11(13,14)15)2-3-8(7)12(16,17)18/h2-4,9H,5,19H2,1H3/t9-/m1/s1 |
| InChIKey | FQIFWEUGEYRHPQ-SECBINFHSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |