C11H12Cl2F3NO2 — CID 171251443
methyl (3R)-3-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate;hydrochloride (PubChem CID 171251443) has the molecular formula C11H12Cl2F3NO2 and a molecular weight of 318.12 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171251443 |
| Molecular Formula | C11H12Cl2F3NO2 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | methyl (3R)-3-amino-3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1ccc(C(F)(F)F)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H11ClF3NO2.ClH/c1-18-10(17)5-9(16)6-2-3-7(8(12)4-6)11(13,14)15;/h2-4,9H,5,16H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | HHXLFKYIIHKRDK-SBSPUUFOSA-N |
| XLogP | 3.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |