C11H12ClF4NO2 — CID 171240523
methyl (3S)-3-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate;hydrochloride (PubChem CID 171240523) has the molecular formula C11H12ClF4NO2 and a molecular weight of 301.67 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171240523 |
| Molecular Formula | C11H12ClF4NO2 |
| Molecular Weight | 301.67 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | methyl (3S)-3-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1ccc(F)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H11F4NO2.ClH/c1-18-10(17)5-9(16)6-2-3-8(12)7(4-6)11(13,14)15;/h2-4,9H,5,16H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | ZFJNXPFBSMDDPV-FVGYRXGTSA-N |
| XLogP | 2.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |