C10H11ClFNO2 — CID 79021226
methyl (3R)-3-amino-3-(3-chloro-4-fluorophenyl)propanoate (PubChem CID 79021226) has the molecular formula C10H11ClFNO2 and a molecular weight of 231.65 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3-chloro-4-fluorophenyl)propanoate.
| Compound Name | methyl (3R)-3-amino-3-(3-chloro-4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 79021226 |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | methyl (3R)-3-amino-3-(3-chloro-4-fluorophenyl)propanoate |
| SMILES | COC(=O)C[C@@H](N)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClFNO2/c1-15-10(14)5-9(13)6-2-3-8(12)7(11)4-6/h2-4,9H,5,13H2,1H3/t9-/m1/s1 |
| InChIKey | DZEVUVZWOJQEBX-SECBINFHSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |