methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate

C10H11F2NO2 — CID 29059566

IUPACmethyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate
SMILESCOC(=O)C[C@@H](N)c1ccc(F)c(F)c1
InChIInChI=1S/C10H11F2NO2/c1-15-10(14)5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9H,5,13H2,1H3/t9-/m1/s1
InChIKeySNQGXWOBHKSJDZ-SECBINFHSA-N
MW215.20 g/mol
LogP1.53
Rot. Bonds3

About methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate

methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate (PubChem CID 29059566) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate.

Molecular Properties

Compound Namemethyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate
PubChem CID29059566
Molecular FormulaC10H11F2NO2
Molecular Weight215.20 g/mol
Exact Mass215.08
IUPAC Namemethyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate
SMILESCOC(=O)C[C@@H](N)c1ccc(F)c(F)c1
InChIInChI=1S/C10H11F2NO2/c1-15-10(14)5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9H,5,13H2,1H3/t9-/m1/s1
InChIKeySNQGXWOBHKSJDZ-SECBINFHSA-N
XLogP1.53
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.20
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate?
The IUPAC name of methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate (CID 29059566) is methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate.
What is the SMILES notation for methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate?
The canonical SMILES for methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate is COC(=O)C[C@@H](N)c1ccc(F)c(F)c1.
What is the InChIKey of methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate?
The InChIKey is SNQGXWOBHKSJDZ-SECBINFHSA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-15-10(14)5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9H,5,13H2,1H3/t9-/m1/s1.
What are the key properties of methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate?
methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate has a molecular weight of 215.20 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-amino-3-(3,4-difluorophenyl)propanoate is sourced from PubChem (CID 29059566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).