C10H10F2O3 — CID 138605518
methyl (3R)-3-(3,4-difluorophenyl)-3-hydroxypropanoate (PubChem CID 138605518) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is methyl (3R)-3-(3,4-difluorophenyl)-3-hydroxypropanoate.
| Compound Name | methyl (3R)-3-(3,4-difluorophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 138605518 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | methyl (3R)-3-(3,4-difluorophenyl)-3-hydroxypropanoate |
| SMILES | COC(=O)C[C@@H](O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H10F2O3/c1-15-10(14)5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9,13H,5H2,1H3/t9-/m1/s1 |
| InChIKey | OFCUIAGMQILSIM-SECBINFHSA-N |
| XLogP | 1.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |