C11H12ClF4NO3 — CID 171255740
methyl (3S)-3-amino-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate;hydrochloride (PubChem CID 171255740) has the molecular formula C11H12ClF4NO3 and a molecular weight of 317.67 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171255740 |
| Molecular Formula | C11H12ClF4NO3 |
| Molecular Weight | 317.67 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | methyl (3S)-3-amino-3-[3-fluoro-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1c(C(F)(F)F)ccc(F)c1O.Cl |
| InChI | InChI=1S/C11H11F4NO3.ClH/c1-19-8(17)4-7(16)9-5(11(13,14)15)2-3-6(12)10(9)18;/h2-3,7,18H,4,16H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | XUMREUPVINFSQK-FJXQXJEOSA-N |
| XLogP | 2.53 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|