C12H14ClF4NO — CID 171259131
2-[(1R)-1-amino-3-methylbut-3-enyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride (PubChem CID 171259131) has the molecular formula C12H14ClF4NO and a molecular weight of 299.70 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-methylbut-3-enyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-methylbut-3-enyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 171259131 |
| Molecular Formula | C12H14ClF4NO |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[(1R)-1-amino-3-methylbut-3-enyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1c(C(F)(F)F)ccc(F)c1O.Cl |
| InChI | InChI=1S/C12H13F4NO.ClH/c1-6(2)5-9(17)10-7(12(14,15)16)3-4-8(13)11(10)18;/h3-4,9,18H,1,5,17H2,2H3;1H/t9-;/m1./s1 |
| InChIKey | PJQCNXRTYQYLBF-SBSPUUFOSA-N |
| XLogP | 3.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|