C10H11F4NO — CID 131292479
2-[(1S)-1-aminopropyl]-6-fluoro-3-(trifluoromethyl)phenol (PubChem CID 131292479) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-[(1S)-1-aminopropyl]-6-fluoro-3-(trifluoromethyl)phenol.
| Compound Name | 2-[(1S)-1-aminopropyl]-6-fluoro-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 131292479 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-[(1S)-1-aminopropyl]-6-fluoro-3-(trifluoromethyl)phenol |
| SMILES | CC[C@H](N)c1c(C(F)(F)F)ccc(F)c1O |
| InChI | InChI=1S/C10H11F4NO/c1-2-7(15)8-5(10(12,13)14)3-4-6(11)9(8)16/h3-4,7,16H,2,15H2,1H3/t7-/m0/s1 |
| InChIKey | FCERQOZQJWALOD-ZETCQYMHSA-N |
| XLogP | 2.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|