C10H12ClF4N — CID 171227313
(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (PubChem CID 171227313) has the molecular formula C10H12ClF4N and a molecular weight of 257.66 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227313 |
| Molecular Formula | C10H12ClF4N |
| Molecular Weight | 257.66 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| SMILES | CC[C@H](N)c1c(F)cccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C10H11F4N.ClH/c1-2-8(15)9-6(10(12,13)14)4-3-5-7(9)11;/h3-5,8H,2,15H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | CBACTTGJYLYWGI-QRPNPIFTSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |