C9H9F4NO — CID 77129940
2-amino-2-[2-fluoro-6-(trifluoromethyl)phenyl]ethanol (PubChem CID 77129940) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 2-amino-2-[2-fluoro-6-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-amino-2-[2-fluoro-6-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 77129940 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-amino-2-[2-fluoro-6-(trifluoromethyl)phenyl]ethanol |
| SMILES | NC(CO)c1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H9F4NO/c10-6-3-1-2-5(9(11,12)13)8(6)7(14)4-15/h1-3,7,15H,4,14H2 |
| InChIKey | YFEKUBJIKOECBB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |