C9H10ClF4NO2 — CID 171259080
2-[(1S)-1-amino-2-hydroxyethyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride (PubChem CID 171259080) has the molecular formula C9H10ClF4NO2 and a molecular weight of 275.63 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-hydroxyethyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 171259080 |
| Molecular Formula | C9H10ClF4NO2 |
| Molecular Weight | 275.63 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-fluoro-3-(trifluoromethyl)phenol;hydrochloride |
| SMILES | Cl.N[C@H](CO)c1c(C(F)(F)F)ccc(F)c1O |
| InChI | InChI=1S/C9H9F4NO2.ClH/c10-5-2-1-4(9(11,12)13)7(8(5)16)6(14)3-15;/h1-2,6,15-16H,3,14H2;1H/t6-;/m1./s1 |
| InChIKey | UKRQPSYUCDHYFJ-FYZOBXCZSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.63 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|