C9H9ClF3NO2 — CID 66515318
2-[(1S)-1-amino-2-hydroxyethyl]-6-chloro-3-(trifluoromethyl)phenol (PubChem CID 66515318) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-hydroxyethyl]-6-chloro-3-(trifluoromethyl)phenol.
| Compound Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-chloro-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 66515318 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-chloro-3-(trifluoromethyl)phenol |
| SMILES | N[C@H](CO)c1c(C(F)(F)F)ccc(Cl)c1O |
| InChI | InChI=1S/C9H9ClF3NO2/c10-5-2-1-4(9(11,12)13)7(8(5)16)6(14)3-15/h1-2,6,15-16H,3,14H2/t6-/m1/s1 |
| InChIKey | MCEZIMNLFZESJW-ZCFIWIBFSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|