C11H12ClF4NO — CID 171228882
(4S)-4-amino-4-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 171228882) has the molecular formula C11H12ClF4NO and a molecular weight of 285.67 g/mol. Its IUPAC name is (4S)-4-amino-4-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | (4S)-4-amino-4-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 171228882 |
| Molecular Formula | C11H12ClF4NO |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (4S)-4-amino-4-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | N[C@@H](CCCO)c1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C11H12ClF4NO/c12-7-4-3-6(11(14,15)16)9(10(7)13)8(17)2-1-5-18/h3-4,8,18H,1-2,5,17H2/t8-/m0/s1 |
| InChIKey | BLDYZOZPTGZWAD-QMMMGPOBSA-N |
| XLogP | 3.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |