C10H14Cl2FNO — CID 171200181
(4R)-4-amino-4-(2-chloro-6-fluorophenyl)butan-1-ol;hydrochloride (PubChem CID 171200181) has the molecular formula C10H14Cl2FNO and a molecular weight of 254.13 g/mol. Its IUPAC name is (4R)-4-amino-4-(2-chloro-6-fluorophenyl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(2-chloro-6-fluorophenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171200181 |
| Molecular Formula | C10H14Cl2FNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | (4R)-4-amino-4-(2-chloro-6-fluorophenyl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCCO)c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H13ClFNO.ClH/c11-7-3-1-4-8(12)10(7)9(13)5-2-6-14;/h1,3-4,9,14H,2,5-6,13H2;1H/t9-;/m1./s1 |
| InChIKey | LKOURKYXCKRUMC-SBSPUUFOSA-N |
| XLogP | 2.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |