C10H14Cl3NO — CID 171217462
(4S)-4-amino-4-(2,6-dichlorophenyl)butan-1-ol;hydrochloride (PubChem CID 171217462) has the molecular formula C10H14Cl3NO and a molecular weight of 270.59 g/mol. Its IUPAC name is (4S)-4-amino-4-(2,6-dichlorophenyl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-(2,6-dichlorophenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171217462 |
| Molecular Formula | C10H14Cl3NO |
| Molecular Weight | 270.59 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | (4S)-4-amino-4-(2,6-dichlorophenyl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H](CCCO)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H13Cl2NO.ClH/c11-7-3-1-4-8(12)10(7)9(13)5-2-6-14;/h1,3-4,9,14H,2,5-6,13H2;1H/t9-;/m0./s1 |
| InChIKey | GLHHMCMUYUYMQJ-FVGYRXGTSA-N |
| XLogP | 3.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |