C10H15Cl3N2 — CID 171217426
(1S)-1-(2,6-dichlorophenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171217426) has the molecular formula C10H15Cl3N2 and a molecular weight of 269.60 g/mol. Its IUPAC name is (1S)-1-(2,6-dichlorophenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(2,6-dichlorophenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171217426 |
| Molecular Formula | C10H15Cl3N2 |
| Molecular Weight | 269.60 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (1S)-1-(2,6-dichlorophenyl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H14Cl2N2.ClH/c11-7-3-1-4-8(12)10(7)9(14)5-2-6-13;/h1,3-4,9H,2,5-6,13-14H2;1H/t9-;/m0./s1 |
| InChIKey | ZZPZZLUQVYTHIB-FVGYRXGTSA-N |
| XLogP | 3.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |