C12H15Cl2N — CID 104986705
1-(2,6-dichlorophenyl)hex-5-en-1-amine (PubChem CID 104986705) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)hex-5-en-1-amine.
| Compound Name | 1-(2,6-dichlorophenyl)hex-5-en-1-amine |
|---|---|
| PubChem CID | 104986705 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)hex-5-en-1-amine |
| SMILES | C=CCCCC(N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2N/c1-2-3-4-8-11(15)12-9(13)6-5-7-10(12)14/h2,5-7,11H,1,3-4,8,15H2 |
| InChIKey | YGBAGPKXVJPGQF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|