C11H14Cl2FN — CID 171209326
(1R)-1-(3-chloro-2-fluorophenyl)pent-4-en-1-amine;hydrochloride (PubChem CID 171209326) has the molecular formula C11H14Cl2FN and a molecular weight of 250.14 g/mol. Its IUPAC name is (1R)-1-(3-chloro-2-fluorophenyl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3-chloro-2-fluorophenyl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171209326 |
| Molecular Formula | C11H14Cl2FN |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (1R)-1-(3-chloro-2-fluorophenyl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1cccc(Cl)c1F.Cl |
| InChI | InChI=1S/C11H13ClFN.ClH/c1-2-3-7-10(14)8-5-4-6-9(12)11(8)13;/h2,4-6,10H,1,3,7,14H2;1H/t10-;/m1./s1 |
| InChIKey | VWGGZWVVTRTWRY-HNCPQSOCSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|