C10H10ClF4N — CID 171228901
(1S)-1-(3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171228901) has the molecular formula C10H10ClF4N and a molecular weight of 255.64 g/mol. Its IUPAC name is (1S)-1-(3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1S)-1-(3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171228901 |
| Molecular Formula | C10H10ClF4N |
| Molecular Weight | 255.64 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (1S)-1-(3-chloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | N[C@@H](CCC(F)(F)F)c1cccc(Cl)c1F |
| InChI | InChI=1S/C10H10ClF4N/c11-7-3-1-2-6(9(7)12)8(16)4-5-10(13,14)15/h1-3,8H,4-5,16H2/t8-/m0/s1 |
| InChIKey | VJHXJTABXGWRNX-QMMMGPOBSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |