C10H14ClFN2 — CID 171209299
(1R)-1-(3-chloro-2-fluorophenyl)butane-1,4-diamine (PubChem CID 171209299) has the molecular formula C10H14ClFN2 and a molecular weight of 216.69 g/mol. Its IUPAC name is (1R)-1-(3-chloro-2-fluorophenyl)butane-1,4-diamine.
| Compound Name | (1R)-1-(3-chloro-2-fluorophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171209299 |
| Molecular Formula | C10H14ClFN2 |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1R)-1-(3-chloro-2-fluorophenyl)butane-1,4-diamine |
| SMILES | NCCC[C@@H](N)c1cccc(Cl)c1F |
| InChI | InChI=1S/C10H14ClFN2/c11-8-4-1-3-7(10(8)12)9(14)5-2-6-13/h1,3-4,9H,2,5-6,13-14H2/t9-/m1/s1 |
| InChIKey | YTTFKXKWJULURW-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |