C10H9Cl2F4N — CID 171215638
(1R)-1-(3,6-dichloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171215638) has the molecular formula C10H9Cl2F4N and a molecular weight of 290.09 g/mol. Its IUPAC name is (1R)-1-(3,6-dichloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1R)-1-(3,6-dichloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171215638 |
| Molecular Formula | C10H9Cl2F4N |
| Molecular Weight | 290.09 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (1R)-1-(3,6-dichloro-2-fluorophenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | N[C@H](CCC(F)(F)F)c1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C10H9Cl2F4N/c11-5-1-2-6(12)9(13)8(5)7(17)3-4-10(14,15)16/h1-2,7H,3-4,17H2/t7-/m1/s1 |
| InChIKey | IWFTYUICVJNCEW-SSDOTTSWSA-N |
| XLogP | 4.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|