C8H8Cl3F2N — CID 171215618
(1S)-1-(3,6-dichloro-2-fluorophenyl)-2-fluoroethanamine;hydrochloride (PubChem CID 171215618) has the molecular formula C8H8Cl3F2N and a molecular weight of 262.51 g/mol. Its IUPAC name is (1S)-1-(3,6-dichloro-2-fluorophenyl)-2-fluoroethanamine;hydrochloride.
| Compound Name | (1S)-1-(3,6-dichloro-2-fluorophenyl)-2-fluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171215618 |
| Molecular Formula | C8H8Cl3F2N |
| Molecular Weight | 262.51 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | (1S)-1-(3,6-dichloro-2-fluorophenyl)-2-fluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@H](CF)c1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C8H7Cl2F2N.ClH/c9-4-1-2-5(10)8(12)7(4)6(13)3-11;/h1-2,6H,3,13H2;1H/t6-;/m1./s1 |
| InChIKey | SWOUOHQSBLMJIZ-FYZOBXCZSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|