C11H13Cl3FNO2 — CID 171235294
ethyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride (PubChem CID 171235294) has the molecular formula C11H13Cl3FNO2 and a molecular weight of 316.59 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171235294 |
| Molecular Formula | C11H13Cl3FNO2 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3,6-dichloro-2-fluorophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1c(Cl)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C11H12Cl2FNO2.ClH/c1-2-17-9(16)5-8(15)10-6(12)3-4-7(13)11(10)14;/h3-4,8H,2,5,15H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | STYJJESFYRUYBH-QRPNPIFTSA-N |
| XLogP | 3.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|