C11H10ClF4NO2 — CID 171242740
methyl (3S)-3-amino-3-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]propanoate (PubChem CID 171242740) has the molecular formula C11H10ClF4NO2 and a molecular weight of 299.65 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (3S)-3-amino-3-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171242740 |
| Molecular Formula | C11H10ClF4NO2 |
| Molecular Weight | 299.65 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | methyl (3S)-3-amino-3-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](N)c1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C11H10ClF4NO2/c1-19-8(18)4-7(17)9-5(11(14,15)16)2-3-6(12)10(9)13/h2-3,7H,4,17H2,1H3/t7-/m0/s1 |
| InChIKey | PKVSFTXIPFKPAD-ZETCQYMHSA-N |
| XLogP | 3.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |