C11H13Cl2F2NO2 — CID 171228607
ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)propanoate;hydrochloride (PubChem CID 171228607) has the molecular formula C11H13Cl2F2NO2 and a molecular weight of 300.13 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171228607 |
| Molecular Formula | C11H13Cl2F2NO2 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-chloro-2,6-difluorophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1c(F)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C11H12ClF2NO2.ClH/c1-2-17-9(16)5-8(15)10-7(13)4-3-6(12)11(10)14;/h3-4,8H,2,5,15H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | JXFWSNYCONLQFQ-QRPNPIFTSA-N |
| XLogP | 2.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|