C11H12BrF2NO2 — CID 171205164
ethyl (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)propanoate (PubChem CID 171205164) has the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 171205164 |
| Molecular Formula | C11H12BrF2NO2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | ethyl (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)propanoate |
| SMILES | CCOC(=O)C[C@@H](N)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H12BrF2NO2/c1-2-17-9(16)5-8(15)10-7(13)4-3-6(12)11(10)14/h3-4,8H,2,5,15H2,1H3/t8-/m1/s1 |
| InChIKey | AAHMTKMPYPCKMI-MRVPVSSYSA-N |
| XLogP | 2.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|