C12H16BrF2NO2 — CID 106942803
1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethanamine (PubChem CID 106942803) has the molecular formula C12H16BrF2NO2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethanamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 106942803 |
| Molecular Formula | C12H16BrF2NO2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethanamine |
| SMILES | CCOC(OCC)C(N)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H16BrF2NO2/c1-3-17-12(18-4-2)11(16)9-8(14)6-5-7(13)10(9)15/h5-6,11-12H,3-4,16H2,1-2H3 |
| InChIKey | ZFNKRRNUSIKRIL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|