C11H15BrClF2NO — CID 171268152
(1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)-3-methylbutan-2-ol;hydrochloride (PubChem CID 171268152) has the molecular formula C11H15BrClF2NO and a molecular weight of 330.60 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)-3-methylbutan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)-3-methylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171268152 |
| Molecular Formula | C11H15BrClF2NO |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | (1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)-3-methylbutan-2-ol;hydrochloride |
| SMILES | CC(C)[C@@H](O)[C@@H](N)c1c(F)ccc(Br)c1F.Cl |
| InChI | InChI=1S/C11H14BrF2NO.ClH/c1-5(2)11(16)10(15)8-7(13)4-3-6(12)9(8)14;/h3-5,10-11,16H,15H2,1-2H3;1H/t10-,11+;/m0./s1 |
| InChIKey | MCGXGQFOTQLTOJ-VZXYPILPSA-N |
| XLogP | 3.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|