C9H11BrClF2N — CID 171224706
(1S)-1-(3-bromo-2,6-difluorophenyl)propan-1-amine;hydrochloride (PubChem CID 171224706) has the molecular formula C9H11BrClF2N and a molecular weight of 286.55 g/mol. Its IUPAC name is (1S)-1-(3-bromo-2,6-difluorophenyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3-bromo-2,6-difluorophenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171224706 |
| Molecular Formula | C9H11BrClF2N |
| Molecular Weight | 286.55 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | (1S)-1-(3-bromo-2,6-difluorophenyl)propan-1-amine;hydrochloride |
| SMILES | CC[C@H](N)c1c(F)ccc(Br)c1F.Cl |
| InChI | InChI=1S/C9H10BrF2N.ClH/c1-2-7(13)8-6(11)4-3-5(10)9(8)12;/h3-4,7H,2,13H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | WSRVPRLQLLVNSY-FJXQXJEOSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|